C22H23Cl2NO5 — CID 16556562
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 16556562) has the molecular formula C22H23Cl2NO5 and a molecular weight of 452.33 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 16556562 |
| Molecular Formula | C22H23Cl2NO5 |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2NO5/c1-2-4-21(27)25-17-9-6-15(7-10-17)19(26)14-30-22(28)5-3-12-29-20-11-8-16(23)13-18(20)24/h6-11,13H,2-5,12,14H2,1H3,(H,25,27) |
| InChIKey | ATKKLMSNVGGQRE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|