C19H19Cl2NO5 — CID 2357919
[2-(4-methoxyanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 2357919) has the molecular formula C19H19Cl2NO5 and a molecular weight of 412.27 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 2357919 |
| Molecular Formula | C19H19Cl2NO5 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2NO5/c1-25-15-7-5-14(6-8-15)22-18(23)12-27-19(24)3-2-10-26-17-9-4-13(20)11-16(17)21/h4-9,11H,2-3,10,12H2,1H3,(H,22,23) |
| InChIKey | CQDVNQVDLABSQP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|