C19H18BrCl2NO4 — CID 17260200
[2-(4-bromo-3-methylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 17260200) has the molecular formula C19H18BrCl2NO4 and a molecular weight of 475.17 g/mol. Its IUPAC name is [2-(4-bromo-3-methylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 17260200 |
| Molecular Formula | C19H18BrCl2NO4 |
| Molecular Weight | 475.17 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | Cc1cc(NC(=O)COC(=O)CCCOc2ccc(Cl)cc2Cl)ccc1Br |
| InChI | InChI=1S/C19H18BrCl2NO4/c1-12-9-14(5-6-15(12)20)23-18(24)11-27-19(25)3-2-8-26-17-7-4-13(21)10-16(17)22/h4-7,9-10H,2-3,8,11H2,1H3,(H,23,24) |
| InChIKey | UHGJJTORWYVYOW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.17 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|