C15H14Cl2N2O5 — CID 16595399
[2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 16595399) has the molecular formula C15H14Cl2N2O5 and a molecular weight of 373.19 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 16595399 |
| Molecular Formula | C15H14Cl2N2O5 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | O=C(COC(=O)CCCOc1ccc(Cl)cc1Cl)Nc1ccon1 |
| InChI | InChI=1S/C15H14Cl2N2O5/c16-10-3-4-12(11(17)8-10)22-6-1-2-15(21)23-9-14(20)18-13-5-7-24-19-13/h3-5,7-8H,1-2,6,9H2,(H,18,19,20) |
| InChIKey | NTPGNMOGQZHHKB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|