C20H27Cl2NO4 — CID 11917062
[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 11917062) has the molecular formula C20H27Cl2NO4 and a molecular weight of 416.35 g/mol. Its IUPAC name is [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 11917062 |
| Molecular Formula | C20H27Cl2NO4 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)COC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H27Cl2NO4/c1-13-5-3-6-17(14(13)2)23-19(24)12-27-20(25)7-4-10-26-18-9-8-15(21)11-16(18)22/h8-9,11,13-14,17H,3-7,10,12H2,1-2H3,(H,23,24)/t13-,14+,17+/m0/s1 |
| InChIKey | AJBJYIWZJYWDJP-JJRVBVJISA-N |
| XLogP | 4.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|