C16H21BrClNO2 — CID 11919791
2-(2-bromo-4-chlorophenoxy)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11919791) has the molecular formula C16H21BrClNO2 and a molecular weight of 374.71 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11919791 |
| Molecular Formula | C16H21BrClNO2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C16H21BrClNO2/c1-10-4-3-5-14(11(10)2)19-16(20)9-21-15-7-6-12(18)8-13(15)17/h6-8,10-11,14H,3-5,9H2,1-2H3,(H,19,20)/t10-,11-,14+/m1/s1 |
| InChIKey | JTKHRSAXFQQAQD-GYSYKLTISA-N |
| XLogP | 4.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |