C17H23ClN2O3 — CID 9362464
5-chloro-2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethoxy]benzamide (PubChem CID 9362464) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 5-chloro-2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethoxy]benzamide.
| Compound Name | 5-chloro-2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 9362464 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-chloro-2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethoxy]benzamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)COc1ccc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C17H23ClN2O3/c1-10-4-3-5-14(11(10)2)20-16(21)9-23-15-7-6-12(18)8-13(15)17(19)22/h6-8,10-11,14H,3-5,9H2,1-2H3,(H2,19,22)(H,20,21)/t10-,11+,14+/m1/s1 |
| InChIKey | ZALLFPLKHJUAJP-SUNKGSAMSA-N |
| XLogP | 2.76 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |