C18H25N3O4 — CID 11921212
2-[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethoxy]benzamide (PubChem CID 11921212) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 11921212 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[2-[[(1R,2R,3S)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethoxy]benzamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)NC(=O)COc1ccccc1C(N)=O |
| InChI | InChI=1S/C18H25N3O4/c1-11-6-5-8-14(12(11)2)20-18(24)21-16(22)10-25-15-9-4-3-7-13(15)17(19)23/h3-4,7,9,11-12,14H,5-6,8,10H2,1-2H3,(H2,19,23)(H2,20,21,22,24)/t11-,12+,14+/m0/s1 |
| InChIKey | UVWZQHSVYGJYPE-OUCADQQQSA-N |
| XLogP | 1.81 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |