C16H20ClN3O4 — CID 7867736
[2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 7867736) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is [2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7867736 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [2-[[(1S,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)NC(=O)COC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C16H20ClN3O4/c1-10-5-2-3-7-12(10)19-16(23)20-13(21)9-24-15(22)11-6-4-8-18-14(11)17/h4,6,8,10,12H,2-3,5,7,9H2,1H3,(H2,19,20,21,23)/t10-,12-/m0/s1 |
| InChIKey | KOEPGGAGSKKKSM-JQWIXIFHSA-N |
| XLogP | 2.30 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|