C17H19ClF2N2O4 — CID 8753221
[2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 8753221) has the molecular formula C17H19ClF2N2O4 and a molecular weight of 388.80 g/mol. Its IUPAC name is [2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 8753221 |
| Molecular Formula | C17H19ClF2N2O4 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [2-[[(1R,2S)-2-methylcyclohexyl]carbamoylamino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)NC(=O)COC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H19ClF2N2O4/c1-9-4-2-3-5-14(9)21-17(25)22-15(23)8-26-16(24)10-6-12(19)13(20)7-11(10)18/h6-7,9,14H,2-5,8H2,1H3,(H2,21,22,23,25)/t9-,14+/m0/s1 |
| InChIKey | YWGSQRKCFNQYSQ-LKFCYVNXSA-N |
| XLogP | 3.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|