C16H19Cl2NO3 — CID 7508265
[2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,4-dichlorobenzoate (PubChem CID 7508265) has the molecular formula C16H19Cl2NO3 and a molecular weight of 344.24 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 7508265 |
| Molecular Formula | C16H19Cl2NO3 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2,4-dichlorobenzoate |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)COC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2NO3/c1-10-4-2-3-5-14(10)19-15(20)9-22-16(21)12-7-6-11(17)8-13(12)18/h6-8,10,14H,2-5,9H2,1H3,(H,19,20)/t10-,14-/m1/s1 |
| InChIKey | OZYARTLFPCLONK-QMTHXVAHSA-N |
| XLogP | 3.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |