C16H18ClF2NO3 — CID 2565802
[2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2565802) has the molecular formula C16H18ClF2NO3 and a molecular weight of 345.77 g/mol. Its IUPAC name is [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2565802 |
| Molecular Formula | C16H18ClF2NO3 |
| Molecular Weight | 345.77 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)COC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H18ClF2NO3/c1-9-4-2-3-5-14(9)20-15(21)8-23-16(22)10-6-12(18)13(19)7-11(10)17/h6-7,9,14H,2-5,8H2,1H3,(H,20,21)/t9-,14+/m1/s1 |
| InChIKey | IPKXFPQFQAEVOJ-OTYXRUKQSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|