C16H20Cl2N2O3 — CID 2620409
[2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 2620409) has the molecular formula C16H20Cl2N2O3 and a molecular weight of 359.25 g/mol. Its IUPAC name is [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2620409 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)COC(=O)c1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C16H20Cl2N2O3/c1-9-4-2-3-5-13(9)20-14(21)8-23-16(22)11-6-10(17)7-12(18)15(11)19/h6-7,9,13H,2-5,8,19H2,1H3,(H,20,21)/t9-,13+/m1/s1 |
| InChIKey | JELJQCVZZIFEPV-RNCFNFMXSA-N |
| XLogP | 3.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|