C16H19Cl2N3O4 — CID 2634309
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 2634309) has the molecular formula C16H19Cl2N3O4 and a molecular weight of 388.25 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2634309 |
| Molecular Formula | C16H19Cl2N3O4 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | Nc1c(Cl)cc(Cl)cc1C(=O)OCC(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H19Cl2N3O4/c17-9-6-11(14(19)12(18)7-9)15(23)25-8-13(22)21-16(24)20-10-4-2-1-3-5-10/h6-7,10H,1-5,8,19H2,(H2,20,21,22,24) |
| InChIKey | XRBUJFNHGHUAET-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|