C12H12Cl2N2O5 — CID 2620423
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 2620423) has the molecular formula C12H12Cl2N2O5 and a molecular weight of 335.14 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2620423 |
| Molecular Formula | C12H12Cl2N2O5 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C12H12Cl2N2O5/c1-2-20-12(19)16-9(17)5-21-11(18)7-3-6(13)4-8(14)10(7)15/h3-4H,2,5,15H2,1H3,(H,16,17,19) |
| InChIKey | IQTFMOQHJMUXHK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|