C17H15Cl2NO3 — CID 7864776
[2-(2,4-dimethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 7864776) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7864776 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cc(Cl)cc(Cl)c2N)c(C)c1 |
| InChI | InChI=1S/C17H15Cl2NO3/c1-9-3-4-12(10(2)5-9)15(21)8-23-17(22)13-6-11(18)7-14(19)16(13)20/h3-7H,8,20H2,1-2H3 |
| InChIKey | CIMTUDLIWAHGQX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|