C24H20O4 — CID 2569453
[2-(2,4-dimethylphenyl)-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 2569453) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 2569453 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(C(=O)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H20O4/c1-16-8-13-21(17(2)14-16)22(25)15-28-24(27)20-11-9-19(10-12-20)23(26)18-6-4-3-5-7-18/h3-14H,15H2,1-2H3 |
| InChIKey | CWFPWVVEHGPRPX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |