About [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 7203764) has the molecular formula C23H17NO6
and a molecular weight of 403.39 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate.
Molecular Properties
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate |
| PubChem CID | 7203764 |
| Molecular Formula | C23H17NO6 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(C(=O)c3ccccc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17NO6/c1-15-7-8-19(13-20(15)24(28)29)21(25)14-30-23(27)18-11-9-17(10-12-18)22(26)16-5-3-2-4-6-16/h2-13H,14H2,1H3 |
| InChIKey | NBYJUWKHWDNUQZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate?
The IUPAC name of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate (CID 7203764) is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate.
What is the SMILES notation for [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate?
The canonical SMILES for [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate is Cc1ccc(C(=O)COC(=O)c2ccc(C(=O)c3ccccc3)cc2)cc1[N+](=O)[O-].
What is the InChIKey of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate?
The InChIKey is NBYJUWKHWDNUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO6/c1-15-7-8-19(13-20(15)24(28)29)21(25)14-30-23(27)18-11-9-17(10-12-18)22(26)16-5-3-2-4-6-16/h2-13H,14H2,1H3.
What are the key properties of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate?
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate has a molecular weight of 403.39 g/mol, XLogP of 4.17, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 4-benzoylbenzoate is sourced from PubChem (CID 7203764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).