About [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate (PubChem CID 8753912) has the molecular formula C19H19NO5
and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate.
Molecular Properties
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate |
| PubChem CID | 8753912 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate |
| SMILES | CC[C@H](C(=O)OCC(=O)c1ccc(C)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO5/c1-3-16(14-7-5-4-6-8-14)19(22)25-12-18(21)15-10-9-13(2)17(11-15)20(23)24/h4-11,16H,3,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | VFXNOMMJAIEDPW-INIZCTEOSA-N |
| XLogP | 3.82 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
The IUPAC name of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate (CID 8753912) is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate.
What is the SMILES notation for [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
The canonical SMILES for [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate is CC[C@H](C(=O)OCC(=O)c1ccc(C)c([N+](=O)[O-])c1)c1ccccc1.
What is the InChIKey of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
The InChIKey is VFXNOMMJAIEDPW-INIZCTEOSA-N. The full InChI is InChI=1S/C19H19NO5/c1-3-16(14-7-5-4-6-8-14)19(22)25-12-18(21)15-10-9-13(2)17(11-15)20(23)24/h4-11,16H,3,12H2,1-2H3/t16-/m0/s1.
What are the key properties of [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate?
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate has a molecular weight of 341.36 g/mol, XLogP of 3.82, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] (2S)-2-phenylbutanoate is sourced from PubChem (CID 8753912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).