C19H18O5 — CID 8753923
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (2R)-2-phenylbutanoate (PubChem CID 8753923) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (2R)-2-phenylbutanoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 8753923 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)OCC(=O)c1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C19H18O5/c1-2-15(13-6-4-3-5-7-13)19(21)22-11-16(20)14-8-9-17-18(10-14)24-12-23-17/h3-10,15H,2,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | RGDJOFNXUVUOPR-OAHLLOKOSA-N |
| XLogP | 3.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |