[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate

C17H13ClO5 — CID 8632154

IUPAC[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate
SMILESO=C(Cc1ccccc1Cl)OCC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C17H13ClO5/c18-13-4-2-1-3-11(13)8-17(20)21-9-14(19)12-5-6-15-16(7-12)23-10-22-15/h1-7H,8-10H2
InChIKeyXUHIZLSSDUXSJR-UHFFFAOYSA-N
MW332.74 g/mol
LogP3.04
Rot. Bonds5

About [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate

[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate (PubChem CID 8632154) has the molecular formula C17H13ClO5 and a molecular weight of 332.74 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate.

Molecular Properties

Compound Name[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate
PubChem CID8632154
Molecular FormulaC17H13ClO5
Molecular Weight332.74 g/mol
Exact Mass332.05
IUPAC Name[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate
SMILESO=C(Cc1ccccc1Cl)OCC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C17H13ClO5/c18-13-4-2-1-3-11(13)8-17(20)21-9-14(19)12-5-6-15-16(7-12)23-10-22-15/h1-7H,8-10H2
InChIKeyXUHIZLSSDUXSJR-UHFFFAOYSA-N
XLogP3.04
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.74
LogP ≤ 53.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate?
The IUPAC name of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate (CID 8632154) is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate.
What is the SMILES notation for [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate?
The canonical SMILES for [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate is O=C(Cc1ccccc1Cl)OCC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate?
The InChIKey is XUHIZLSSDUXSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClO5/c18-13-4-2-1-3-11(13)8-17(20)21-9-14(19)12-5-6-15-16(7-12)23-10-22-15/h1-7H,8-10H2.
What are the key properties of [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate?
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate has a molecular weight of 332.74 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-(2-chlorophenyl)acetate is sourced from PubChem (CID 8632154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).