C14H16O5 — CID 55510766
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-methylbutanoate (PubChem CID 55510766) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-methylbutanoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 55510766 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H16O5/c1-3-9(2)14(16)17-7-11(15)10-4-5-12-13(6-10)19-8-18-12/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | VWLOOTRENPYTLP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |