C13H14O4 — CID 63319607
1-(1,3-benzodioxol-5-yl)-4-methylpentane-1,3-dione (PubChem CID 63319607) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-methylpentane-1,3-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-methylpentane-1,3-dione |
|---|---|
| PubChem CID | 63319607 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-methylpentane-1,3-dione |
| SMILES | CC(C)C(=O)CC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14O4/c1-8(2)10(14)6-11(15)9-3-4-12-13(5-9)17-7-16-12/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | IWDWWMHBZICSBO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|