C12H13NO3 — CID 82114127
1-(1,3-benzodioxol-5-yl)-2-(cyclopropylamino)ethanone (PubChem CID 82114127) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(cyclopropylamino)ethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(cyclopropylamino)ethanone |
|---|---|
| PubChem CID | 82114127 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(cyclopropylamino)ethanone |
| SMILES | O=C(CNC1CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13NO3/c14-10(6-13-9-2-3-9)8-1-4-11-12(5-8)16-7-15-11/h1,4-5,9,13H,2-3,6-7H2 |
| InChIKey | HWOCNLJDGSWQEP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |