C17H14O5 — CID 13263263
1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propane-1,3-dione (PubChem CID 13263263) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 13263263 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propane-1,3-dione |
| SMILES | COc1ccc(C(=O)CC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H14O5/c1-20-13-5-2-11(3-6-13)14(18)9-15(19)12-4-7-16-17(8-12)22-10-21-16/h2-8H,9-10H2,1H3 |
| InChIKey | RLRPSGBCNOXRCF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|