C23H21NO4 — CID 27013788
(3R)-3-anilino-1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propan-1-one (PubChem CID 27013788) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is (3R)-3-anilino-1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | (3R)-3-anilino-1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 27013788 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (3R)-3-anilino-1-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc([C@@H](CC(=O)c2ccc3c(c2)OCO3)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO4/c1-26-19-10-7-16(8-11-19)20(24-18-5-3-2-4-6-18)14-21(25)17-9-12-22-23(13-17)28-15-27-22/h2-13,20,24H,14-15H2,1H3/t20-/m1/s1 |
| InChIKey | OSJNMQORUHUULC-HXUWFJFHSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |