C27H24N2O6 — CID 54710538
3-[3-(1,3-benzodioxol-5-yl)-3-(4-methoxyanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one (PubChem CID 54710538) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)-3-(4-methoxyanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)-3-(4-methoxyanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 54710538 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)-3-(4-methoxyanilino)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
| SMILES | COc1ccc(NC(CC(=O)c2c(O)c3ccccc3n(C)c2=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H24N2O6/c1-29-21-6-4-3-5-19(21)26(31)25(27(29)32)22(30)14-20(28-17-8-10-18(33-2)11-9-17)16-7-12-23-24(13-16)35-15-34-23/h3-13,20,28,31H,14-15H2,1-2H3 |
| InChIKey | SKVKBFZXAYHIKE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|