C31H26N2O4 — CID 54697106
4-hydroxy-3-[3-(2-hydroxyphenyl)-3-(N-phenylanilino)propanoyl]-1-methylquinolin-2-one (PubChem CID 54697106) has the molecular formula C31H26N2O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 4-hydroxy-3-[3-(2-hydroxyphenyl)-3-(N-phenylanilino)propanoyl]-1-methylquinolin-2-one.
| Compound Name | 4-hydroxy-3-[3-(2-hydroxyphenyl)-3-(N-phenylanilino)propanoyl]-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 54697106 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 4-hydroxy-3-[3-(2-hydroxyphenyl)-3-(N-phenylanilino)propanoyl]-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)CC(c2ccccc2O)N(c2ccccc2)c2ccccc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C31H26N2O4/c1-32-25-18-10-8-17-24(25)30(36)29(31(32)37)28(35)20-26(23-16-9-11-19-27(23)34)33(21-12-4-2-5-13-21)22-14-6-3-7-15-22/h2-19,26,34,36H,20H2,1H3 |
| InChIKey | WDUMCFQICQEOIA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|