C19H18N2O4 — CID 54747504
3-[(3S)-3-amino-3-(2-hydroxyphenyl)propanoyl]-4-hydroxy-1-methylquinolin-2-one (PubChem CID 54747504) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-[(3S)-3-amino-3-(2-hydroxyphenyl)propanoyl]-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-[(3S)-3-amino-3-(2-hydroxyphenyl)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 54747504 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-[(3S)-3-amino-3-(2-hydroxyphenyl)propanoyl]-4-hydroxy-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)C[C@H](N)c2ccccc2O)c(O)c2ccccc21 |
| InChI | InChI=1S/C19H18N2O4/c1-21-14-8-4-2-7-12(14)18(24)17(19(21)25)16(23)10-13(20)11-6-3-5-9-15(11)22/h2-9,13,22,24H,10,20H2,1H3/t13-/m0/s1 |
| InChIKey | VQFSVOQFPYIEPP-ZDUSSCGKSA-N |
| XLogP | 2.22 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|