C17H14N2O3 — CID 54676449
4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (PubChem CID 54676449) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide.
| Compound Name | 4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54676449 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2ccccc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C17H14N2O3/c1-19-13-10-6-5-9-12(13)15(20)14(17(19)22)16(21)18-11-7-3-2-4-8-11/h2-10,20H,1H3,(H,18,21) |
| InChIKey | SCIYKTDXFNBCIV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |