C19H18N4O2S — CID 135482678
1-[(E)-1-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)ethylideneamino]-3-phenylthiourea (PubChem CID 135482678) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[(E)-1-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)ethylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-1-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)ethylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 135482678 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[(E)-1-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)ethylideneamino]-3-phenylthiourea |
| SMILES | C/C(=N\NC(=S)Nc1ccccc1)c1c(O)c2ccccc2n(C)c1=O |
| InChI | InChI=1S/C19H18N4O2S/c1-12(21-22-19(26)20-13-8-4-3-5-9-13)16-17(24)14-10-6-7-11-15(14)23(2)18(16)25/h3-11,24H,1-2H3,(H2,20,22,26)/b21-12+ |
| InChIKey | CZYQZAQOSPRLSZ-CIAFOILYSA-N |
| XLogP | 2.95 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|