C18H20N6S2 — CID 54406918
1-phenyl-3-[3-(phenylcarbamothioylhydrazinylidene)butan-2-ylideneamino]thiourea (PubChem CID 54406918) has the molecular formula C18H20N6S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-phenyl-3-[3-(phenylcarbamothioylhydrazinylidene)butan-2-ylideneamino]thiourea.
| Compound Name | 1-phenyl-3-[3-(phenylcarbamothioylhydrazinylidene)butan-2-ylideneamino]thiourea |
|---|---|
| PubChem CID | 54406918 |
| Molecular Formula | C18H20N6S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-phenyl-3-[3-(phenylcarbamothioylhydrazinylidene)butan-2-ylideneamino]thiourea |
| SMILES | CC(=NNC(=S)Nc1ccccc1)C(C)=NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N6S2/c1-13(21-23-17(25)19-15-9-5-3-6-10-15)14(2)22-24-18(26)20-16-11-7-4-8-12-16/h3-12H,1-2H3,(H2,19,23,25)(H2,20,24,26) |
| InChIKey | VRIQZJRYBTXJRE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|