C12H17N3S — CID 131990820
1-[(E)-2,2-dimethylpropylideneamino]-3-phenylthiourea (PubChem CID 131990820) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 1-[(E)-2,2-dimethylpropylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-2,2-dimethylpropylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 131990820 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-[(E)-2,2-dimethylpropylideneamino]-3-phenylthiourea |
| SMILES | CC(C)(C)/C=N/NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C12H17N3S/c1-12(2,3)9-13-15-11(16)14-10-7-5-4-6-8-10/h4-9H,1-3H3,(H2,14,15,16)/b13-9+ |
| InChIKey | QTWLRFPUBSWOOL-UKTHLTGXSA-N |
| XLogP | 3.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|