C23H22N6OS2 — CID 135519262
1-[(E)-[2-hydroxy-5-methyl-3-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]-3-phenylthiourea (PubChem CID 135519262) has the molecular formula C23H22N6OS2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[(E)-[2-hydroxy-5-methyl-3-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[2-hydroxy-5-methyl-3-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 135519262 |
| Molecular Formula | C23H22N6OS2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 1-[(E)-[2-hydroxy-5-methyl-3-[(E)-(phenylcarbamothioylhydrazinylidene)methyl]phenyl]methylideneamino]-3-phenylthiourea |
| SMILES | Cc1cc(/C=N/NC(=S)Nc2ccccc2)c(O)c(/C=N/NC(=S)Nc2ccccc2)c1 |
| InChI | InChI=1S/C23H22N6OS2/c1-16-12-17(14-24-28-22(31)26-19-8-4-2-5-9-19)21(30)18(13-16)15-25-29-23(32)27-20-10-6-3-7-11-20/h2-15,30H,1H3,(H2,26,28,31)(H2,27,29,32)/b24-14+,25-15+ |
| InChIKey | OUAHOTCVVONHBZ-KOJZRSEWSA-N |
| XLogP | 4.34 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|