C20H20N4S — CID 963301
1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-3-phenylthiourea (PubChem CID 963301) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 963301 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-3-phenylthiourea |
| SMILES | Cc1cc(C=NNC(=S)Nc2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H20N4S/c1-15-13-17(16(2)24(15)19-11-7-4-8-12-19)14-21-23-20(25)22-18-9-5-3-6-10-18/h3-14H,1-2H3,(H2,22,23,25) |
| InChIKey | UTCDYVXGOQAHGW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|