C15H14BrN3S — CID 45054455
1-[(E)-(2-bromophenyl)methylideneamino]-3-(3-methylphenyl)thiourea (PubChem CID 45054455) has the molecular formula C15H14BrN3S and a molecular weight of 348.27 g/mol. Its IUPAC name is 1-[(E)-(2-bromophenyl)methylideneamino]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(E)-(2-bromophenyl)methylideneamino]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 45054455 |
| Molecular Formula | C15H14BrN3S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 1-[(E)-(2-bromophenyl)methylideneamino]-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N/N=C/c2ccccc2Br)c1 |
| InChI | InChI=1S/C15H14BrN3S/c1-11-5-4-7-13(9-11)18-15(20)19-17-10-12-6-2-3-8-14(12)16/h2-10H,1H3,(H2,18,19,20)/b17-10+ |
| InChIKey | IQGIDWKOKJGIEC-LICLKQGHSA-N |
| XLogP | 4.08 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|