C16H16BrN3S — CID 5038746
1-[(2-bromophenyl)methylideneamino]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 5038746) has the molecular formula C16H16BrN3S and a molecular weight of 362.30 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methylideneamino]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[(2-bromophenyl)methylideneamino]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 5038746 |
| Molecular Formula | C16H16BrN3S |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 1-[(2-bromophenyl)methylideneamino]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NN=Cc2ccccc2Br)c1C |
| InChI | InChI=1S/C16H16BrN3S/c1-11-6-5-9-15(12(11)2)19-16(21)20-18-10-13-7-3-4-8-14(13)17/h3-10H,1-2H3,(H2,19,20,21) |
| InChIKey | LFWJCPURNVIOIF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|