C22H21N3S — CID 7942915
1-(benzhydrylideneamino)-3-(2,3-dimethylphenyl)thiourea (PubChem CID 7942915) has the molecular formula C22H21N3S and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-(benzhydrylideneamino)-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-(benzhydrylideneamino)-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7942915 |
| Molecular Formula | C22H21N3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(benzhydrylideneamino)-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NN=C(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C22H21N3S/c1-16-10-9-15-20(17(16)2)23-22(26)25-24-21(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-15H,1-2H3,(H2,23,25,26) |
| InChIKey | VVSXOFHXDXXLMR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|