C16H18N2S — CID 799294
1-benzyl-3-(2,3-dimethylphenyl)thiourea (PubChem CID 799294) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 1-benzyl-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-benzyl-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 799294 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-benzyl-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NCc2ccccc2)c1C |
| InChI | InChI=1S/C16H18N2S/c1-12-7-6-10-15(13(12)2)18-16(19)17-11-14-8-4-3-5-9-14/h3-10H,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | PHQOOAAXUWVOHH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|