C16H19NO2 — CID 175448541
N-benzyl-2,3-dimethylaniline;formic acid (PubChem CID 175448541) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-benzyl-2,3-dimethylaniline;formic acid.
| Compound Name | N-benzyl-2,3-dimethylaniline;formic acid |
|---|---|
| PubChem CID | 175448541 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-benzyl-2,3-dimethylaniline;formic acid |
| SMILES | Cc1cccc(NCc2ccccc2)c1C.O=CO |
| InChI | InChI=1S/C15H17N.CH2O2/c1-12-7-6-10-15(13(12)2)16-11-14-8-4-3-5-9-14;2-1-3/h3-10,16H,11H2,1-2H3;1H,(H,2,3) |
| InChIKey | NDWONKQWRKQICC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|