C16H19NO — CID 112630874
[4-[(2,3-dimethylanilino)methyl]phenyl]methanol (PubChem CID 112630874) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is [4-[(2,3-dimethylanilino)methyl]phenyl]methanol.
| Compound Name | [4-[(2,3-dimethylanilino)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 112630874 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | [4-[(2,3-dimethylanilino)methyl]phenyl]methanol |
| SMILES | Cc1cccc(NCc2ccc(CO)cc2)c1C |
| InChI | InChI=1S/C16H19NO/c1-12-4-3-5-16(13(12)2)17-10-14-6-8-15(11-18)9-7-14/h3-9,17-18H,10-11H2,1-2H3 |
| InChIKey | QRZCKVWKXZGIBP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |