C22H22N2O2 — CID 110006557
N-[3-[[4-(hydroxymethyl)phenyl]methylamino]-2-methylphenyl]benzamide (PubChem CID 110006557) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[3-[[4-(hydroxymethyl)phenyl]methylamino]-2-methylphenyl]benzamide.
| Compound Name | N-[3-[[4-(hydroxymethyl)phenyl]methylamino]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 110006557 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[3-[[4-(hydroxymethyl)phenyl]methylamino]-2-methylphenyl]benzamide |
| SMILES | Cc1c(NCc2ccc(CO)cc2)cccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c1-16-20(23-14-17-10-12-18(15-25)13-11-17)8-5-9-21(16)24-22(26)19-6-3-2-4-7-19/h2-13,23,25H,14-15H2,1H3,(H,24,26) |
| InChIKey | JTSGGRMSFRFRPP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |