C22H23NO2 — CID 175448548
benzoic acid;N-benzyl-2,3-dimethylaniline (PubChem CID 175448548) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is benzoic acid;N-benzyl-2,3-dimethylaniline.
| Compound Name | benzoic acid;N-benzyl-2,3-dimethylaniline |
|---|---|
| PubChem CID | 175448548 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | benzoic acid;N-benzyl-2,3-dimethylaniline |
| SMILES | Cc1cccc(NCc2ccccc2)c1C.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C15H17N.C7H6O2/c1-12-7-6-10-15(13(12)2)16-11-14-8-4-3-5-9-14;8-7(9)6-4-2-1-3-5-6/h3-10,16H,11H2,1-2H3;1-5H,(H,8,9) |
| InChIKey | HGHCYKKDZPOUJS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |