C15H16FN — CID 40632168
N-[(4-fluorophenyl)methyl]-2,3-dimethylaniline (PubChem CID 40632168) has the molecular formula C15H16FN and a molecular weight of 229.30 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,3-dimethylaniline.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 40632168 |
| Molecular Formula | C15H16FN |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,3-dimethylaniline |
| SMILES | Cc1cccc(NCc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C15H16FN/c1-11-4-3-5-15(12(11)2)17-10-13-6-8-14(16)9-7-13/h3-9,17H,10H2,1-2H3 |
| InChIKey | NLYLNBIGTHQBKL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |