C16H17F2N — CID 115525992
N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dimethylaniline (PubChem CID 115525992) has the molecular formula C16H17F2N and a molecular weight of 261.31 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dimethylaniline.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 115525992 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dimethylaniline |
| SMILES | Cc1cccc(NCc2cccc(C(F)F)c2)c1C |
| InChI | InChI=1S/C16H17F2N/c1-11-5-3-8-15(12(11)2)19-10-13-6-4-7-14(9-13)16(17)18/h3-9,16,19H,10H2,1-2H3 |
| InChIKey | UMRLAYSGDPPVKB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |