C14H14F2N2 — CID 115526695
N-[[3-(difluoromethyl)phenyl]methyl]-6-methylpyridin-3-amine (PubChem CID 115526695) has the molecular formula C14H14F2N2 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-6-methylpyridin-3-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-6-methylpyridin-3-amine |
|---|---|
| PubChem CID | 115526695 |
| Molecular Formula | C14H14F2N2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-6-methylpyridin-3-amine |
| SMILES | Cc1ccc(NCc2cccc(C(F)F)c2)cn1 |
| InChI | InChI=1S/C14H14F2N2/c1-10-5-6-13(9-17-10)18-8-11-3-2-4-12(7-11)14(15)16/h2-7,9,14,18H,8H2,1H3 |
| InChIKey | KDJRITJEKBCXGS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |