C13H19F2N — CID 115525884
N-[[3-(difluoromethyl)phenyl]methyl]-2-methylbutan-2-amine (PubChem CID 115525884) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2-methylbutan-2-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 115525884 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-methylbutan-2-amine |
| SMILES | CCC(C)(C)NCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C13H19F2N/c1-4-13(2,3)16-9-10-6-5-7-11(8-10)12(14)15/h5-8,12,16H,4,9H2,1-3H3 |
| InChIKey | ZFLOTNBPIYXTFV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |