C11H15F2NO2 — CID 115526569
2-[[3-(difluoromethyl)phenyl]methylamino]propane-1,3-diol (PubChem CID 115526569) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is 2-[[3-(difluoromethyl)phenyl]methylamino]propane-1,3-diol.
| Compound Name | 2-[[3-(difluoromethyl)phenyl]methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 115526569 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[[3-(difluoromethyl)phenyl]methylamino]propane-1,3-diol |
| SMILES | OCC(CO)NCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C11H15F2NO2/c12-11(13)9-3-1-2-8(4-9)5-14-10(6-15)7-16/h1-4,10-11,14-16H,5-7H2 |
| InChIKey | SUBSVOPBPACEOZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |