C12H17F2NO — CID 115526556
4-[[3-(difluoromethyl)phenyl]methylamino]butan-2-ol (PubChem CID 115526556) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 4-[[3-(difluoromethyl)phenyl]methylamino]butan-2-ol.
| Compound Name | 4-[[3-(difluoromethyl)phenyl]methylamino]butan-2-ol |
|---|---|
| PubChem CID | 115526556 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 4-[[3-(difluoromethyl)phenyl]methylamino]butan-2-ol |
| SMILES | CC(O)CCNCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C12H17F2NO/c1-9(16)5-6-15-8-10-3-2-4-11(7-10)12(13)14/h2-4,7,9,12,15-16H,5-6,8H2,1H3 |
| InChIKey | DVXSORUYOMRBKA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|