C13H20F2N2 — CID 113328744
N-[[3-(difluoromethyl)phenyl]methyl]-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 113328744) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-N'-ethyl-N'-methylethane-1,2-diamine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-N'-ethyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 113328744 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C13H20F2N2/c1-3-17(2)8-7-16-10-11-5-4-6-12(9-11)13(14)15/h4-6,9,13,16H,3,7-8,10H2,1-2H3 |
| InChIKey | RVXYALKWJDHJNZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|